C22H31F3N6O2 — CID 164885426
5-[4-[[2-(2,2-difluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide (PubChem CID 164885426) has the molecular formula C22H31F3N6O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 5-[4-[[2-(2,2-difluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[4-[[2-(2,2-difluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 164885426 |
| Molecular Formula | C22H31F3N6O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 5-[4-[[2-(2,2-difluoroethyl)-3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-6-yl]methyl]piperazin-1-yl]-6-fluoro-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN(CC3CCC4NC(CC(F)F)C(=O)NC4C3)CC2)c(F)n1 |
| InChI | InChI=1S/C22H31F3N6O2/c1-26-21(32)15-4-5-18(20(25)28-15)31-8-6-30(7-9-31)12-13-2-3-14-16(10-13)29-22(33)17(27-14)11-19(23)24/h4-5,13-14,16-17,19,27H,2-3,6-12H2,1H3,(H,26,32)(H,29,33) |
| InChIKey | YMRWQQPRIMKULQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|