C35H36F3N5O3 — CID 164885460
(2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxo-3-phenylpropan-2-yl]-N,3,3-trimethyl-2-[(2,4,5-trifluorophenyl)methylamino]butanamide (PubChem CID 164885460) has the molecular formula C35H36F3N5O3 and a molecular weight of 631.70 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxo-3-phenylpropan-2-yl]-N,3,3-trimethyl-2-[(2,4,5-trifluorophenyl)methylamino]butanamide.
| Compound Name | (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxo-3-phenylpropan-2-yl]-N,3,3-trimethyl-2-[(2,4,5-trifluorophenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 164885460 |
| Molecular Formula | C35H36F3N5O3 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2'S,3R)-2'-cyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxo-3-phenylpropan-2-yl]-N,3,3-trimethyl-2-[(2,4,5-trifluorophenyl)methylamino]butanamide |
| SMILES | CN(C(=O)[C@@H](NCc1cc(F)c(F)cc1F)C(C)(C)C)[C@@H](Cc1ccccc1)C(=O)N1C[C@]2(C[C@H]1C#N)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C35H36F3N5O3/c1-34(2,3)30(40-19-22-15-26(37)27(38)16-25(22)36)32(45)42(4)29(14-21-10-6-5-7-11-21)31(44)43-20-35(17-23(43)18-39)24-12-8-9-13-28(24)41-33(35)46/h5-13,15-16,23,29-30,40H,14,17,19-20H2,1-4H3,(H,41,46)/t23-,29-,30+,35-/m0/s1 |
| InChIKey | VUBIUYCQNGNHJZ-ALDASUBGSA-N |
| XLogP | 4.69 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|