C20H36O8S — CID 164886053
1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonic acid (PubChem CID 164886053) has the molecular formula C20H36O8S and a molecular weight of 436.57 g/mol. Its IUPAC name is 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonic acid.
| Compound Name | 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonic acid |
|---|---|
| PubChem CID | 164886053 |
| Molecular Formula | C20H36O8S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-(2,2-dimethylpropoxy)-3-(2,2-dimethylpropoxycarbonyl)-6,6-dimethyl-1,4-dioxoheptane-2-sulfonic acid |
| SMILES | CC(C)(C)COC(=O)C(C(=O)CC(C)(C)C)C(C(=O)OCC(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C20H36O8S/c1-18(2,3)10-13(21)14(16(22)27-11-19(4,5)6)15(29(24,25)26)17(23)28-12-20(7,8)9/h14-15H,10-12H2,1-9H3,(H,24,25,26) |
| InChIKey | VAAZJXBVHVKDJI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|