C29H21F6N3OS2 — CID 164886090
2-[[[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-pyridinyl]methylidenehydrazinylidene]methyl]phenol (PubChem CID 164886090) has the molecular formula C29H21F6N3OS2 and a molecular weight of 605.63 g/mol. Its IUPAC name is 2-[[[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-pyridinyl]methylidenehydrazinylidene]methyl]phenol.
| Compound Name | 2-[[[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-pyridinyl]methylidenehydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 164886090 |
| Molecular Formula | C29H21F6N3OS2 |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 2-[[[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-pyridinyl]methylidenehydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(C2=C(c3cc(-c4ccc(C=NN=Cc5ccccc5O)nc4)sc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C29H21F6N3OS2/c1-15-10-21(16(2)40-15)25-26(28(32,33)29(34,35)27(25,30)31)22-11-24(41-17(22)3)19-8-9-20(36-12-19)14-38-37-13-18-6-4-5-7-23(18)39/h4-14,39H,1-3H3 |
| InChIKey | NUPLNUMGXDGAFF-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|