C46H20F10N4O4 — CID 164886114
2-[15-(2-carboxyphenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 164886114) has the molecular formula C46H20F10N4O4 and a molecular weight of 882.67 g/mol. Its IUPAC name is 2-[15-(2-carboxyphenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 2-[15-(2-carboxyphenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 164886114 |
| Molecular Formula | C46H20F10N4O4 |
| Molecular Weight | 882.67 g/mol |
| Exact Mass | 882.13 |
| IUPAC Name | 2-[15-(2-carboxyphenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2nc(c(-c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)c(-c3ccccc3C(=O)O)c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C46H20F10N4O4/c47-35-33(36(48)40(52)43(55)39(35)51)31-25-13-9-21(57-25)29(17-5-1-3-7-19(17)45(61)62)22-10-14-26(58-22)32(34-37(49)41(53)44(56)42(54)38(34)50)28-16-12-24(60-28)30(23-11-15-27(31)59-23)18-6-2-4-8-20(18)46(63)64/h1-16,57,60H,(H,61,62)(H,63,64)/b29-21-,29-22-,30-23-,30-24-,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | GFOKBARKOAPKSK-IBRKNYKGSA-N |
| XLogP | 12.11 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.67 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|