C18H22F3N3O10 — CID 164886365
(2S)-2-amino-6-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 164886365) has the molecular formula C18H22F3N3O10 and a molecular weight of 497.38 g/mol. Its IUPAC name is (2S)-2-amino-6-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-6-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 164886365 |
| Molecular Formula | C18H22F3N3O10 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (2S)-2-amino-6-[1-(6-nitro-1,3-benzodioxol-5-yl)ethoxycarbonylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(OC(=O)NCCCC[C@H](N)C(=O)O)c1cc2c(cc1[N+](=O)[O-])OCO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O8.C2HF3O2/c1-9(27-16(22)18-5-3-2-4-11(17)15(20)21)10-6-13-14(26-8-25-13)7-12(10)19(23)24;3-2(4,5)1(6)7/h6-7,9,11H,2-5,8,17H2,1H3,(H,18,22)(H,20,21);(H,6,7)/t9?,11-;/m0./s1 |
| InChIKey | PMNPVZYDZLZFTD-VLTGDTDDSA-N |
| XLogP | 2.33 |
| TPSA | 200.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|