C8H12Cl2O3 — CID 164886387
(4S)-4-[[(Z)-1,2-dichloroethenoxy]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 164886387) has the molecular formula C8H12Cl2O3 and a molecular weight of 227.09 g/mol. Its IUPAC name is (4S)-4-[[(Z)-1,2-dichloroethenoxy]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[[(Z)-1,2-dichloroethenoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 164886387 |
| Molecular Formula | C8H12Cl2O3 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | (4S)-4-[[(Z)-1,2-dichloroethenoxy]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H](CO/C(Cl)=C/Cl)O1 |
| InChI | InChI=1S/C8H12Cl2O3/c1-8(2)12-5-6(13-8)4-11-7(10)3-9/h3,6H,4-5H2,1-2H3/b7-3+/t6-/m1/s1 |
| InChIKey | JUYLXTUIUDHQPL-BTJAISLDSA-N |
| XLogP | 2.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|