C23H40O3P2 — CID 164887343
(2R,3R)-3-tert-butyl-2-ditert-butylphosphoryl-4-[(2-methylpropan-2-yl)oxy]-2H-1,3-benzoxaphosphole (PubChem CID 164887343) has the molecular formula C23H40O3P2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (2R,3R)-3-tert-butyl-2-ditert-butylphosphoryl-4-[(2-methylpropan-2-yl)oxy]-2H-1,3-benzoxaphosphole.
| Compound Name | (2R,3R)-3-tert-butyl-2-ditert-butylphosphoryl-4-[(2-methylpropan-2-yl)oxy]-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 164887343 |
| Molecular Formula | C23H40O3P2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (2R,3R)-3-tert-butyl-2-ditert-butylphosphoryl-4-[(2-methylpropan-2-yl)oxy]-2H-1,3-benzoxaphosphole |
| SMILES | CC(C)(C)Oc1cccc2c1[P@@](C(C)(C)C)[C@H](P(=O)(C(C)(C)C)C(C)(C)C)O2 |
| InChI | InChI=1S/C23H40O3P2/c1-20(2,3)26-17-15-13-14-16-18(17)27(21(4,5)6)19(25-16)28(24,22(7,8)9)23(10,11)12/h13-15,19H,1-12H3/t19-,27-/m1/s1 |
| InChIKey | YTSVKNHPNYLCOD-XHCCPWGMSA-N |
| XLogP | 7.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|