C18H15BBrF4N3O — CID 164887368
4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;trifluoroborane;fluoride (PubChem CID 164887368) has the molecular formula C18H15BBrF4N3O and a molecular weight of 456.05 g/mol. Its IUPAC name is 4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;trifluoroborane;fluoride.
| Compound Name | 4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;trifluoroborane;fluoride |
|---|---|
| PubChem CID | 164887368 |
| Molecular Formula | C18H15BBrF4N3O |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-(4-bromophenyl)-8-oxa-4,5-diaza-2-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,11,13,15-pentaene;trifluoroborane;fluoride |
| SMILES | Brc1ccc(-n2c[n+]3c(n2)COC2Cc4ccccc4C23)cc1.FB(F)F.[F-] |
| InChI | InChI=1S/C18H15BrN3O.BF3.FH/c19-13-5-7-14(8-6-13)22-11-21-17(20-22)10-23-16-9-12-3-1-2-4-15(12)18(16)21;2-1(3)4;/h1-8,11,16,18H,9-10H2;;1H/q+1;;/p-1 |
| InChIKey | KTJJZDXEMKJBIH-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|