C31H36ClN5O5S — CID 164887498
27-chloro-4-ethylsulfonyl-21-methyl-19-morpholin-4-yl-10,17-dioxa-4,23,25,28-tetrazapentacyclo[22.3.1.15,9.118,22.02,6]triaconta-1(28),2,5,7,9(30),18,20,22(29),24,26-decaene (PubChem CID 164887498) has the molecular formula C31H36ClN5O5S and a molecular weight of 626.18 g/mol. Its IUPAC name is 27-chloro-4-ethylsulfonyl-21-methyl-19-morpholin-4-yl-10,17-dioxa-4,23,25,28-tetrazapentacyclo[22.3.1.15,9.118,22.02,6]triaconta-1(28),2,5,7,9(30),18,20,22(29),24,26-decaene.
| Compound Name | 27-chloro-4-ethylsulfonyl-21-methyl-19-morpholin-4-yl-10,17-dioxa-4,23,25,28-tetrazapentacyclo[22.3.1.15,9.118,22.02,6]triaconta-1(28),2,5,7,9(30),18,20,22(29),24,26-decaene |
|---|---|
| PubChem CID | 164887498 |
| Molecular Formula | C31H36ClN5O5S |
| Molecular Weight | 626.18 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | 27-chloro-4-ethylsulfonyl-21-methyl-19-morpholin-4-yl-10,17-dioxa-4,23,25,28-tetrazapentacyclo[22.3.1.15,9.118,22.02,6]triaconta-1(28),2,5,7,9(30),18,20,22(29),24,26-decaene |
| SMILES | CCS(=O)(=O)n1cc2c3ccc(cc31)OCCCCCCOc1cc(c(C)cc1N1CCOCC1)Nc1ncc(Cl)c-2n1 |
| InChI | InChI=1S/C31H36ClN5O5S/c1-3-43(38,39)37-20-24-23-9-8-22(17-27(23)37)41-12-6-4-5-7-13-42-29-18-26(34-31-33-19-25(32)30(24)35-31)21(2)16-28(29)36-10-14-40-15-11-36/h8-9,16-20H,3-7,10-15H2,1-2H3,(H,33,34,35) |
| InChIKey | SOZJLUNPQMFFFL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.18 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|