C18H32OSi — CID 164887901
tri(propan-2-yl)-(2-prop-2-enylcyclohexa-1,5-dien-1-yl)oxysilane (PubChem CID 164887901) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is tri(propan-2-yl)-(2-prop-2-enylcyclohexa-1,5-dien-1-yl)oxysilane.
| Compound Name | tri(propan-2-yl)-(2-prop-2-enylcyclohexa-1,5-dien-1-yl)oxysilane |
|---|---|
| PubChem CID | 164887901 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tri(propan-2-yl)-(2-prop-2-enylcyclohexa-1,5-dien-1-yl)oxysilane |
| SMILES | C=CCC1=C(O[Si](C(C)C)(C(C)C)C(C)C)C=CCC1 |
| InChI | InChI=1S/C18H32OSi/c1-8-11-17-12-9-10-13-18(17)19-20(14(2)3,15(4)5)16(6)7/h8,10,13-16H,1,9,11-12H2,2-7H3 |
| InChIKey | ZTOIZYRQIAWCRS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|