C7H16ClNO — CID 164888527
(2S,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride (PubChem CID 164888527) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride.
| Compound Name | (2S,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 164888527 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (2S,6R)-2,6-dimethylpiperidin-4-ol;hydrochloride |
| SMILES | C[C@@H]1CC(O)C[C@H](C)N1.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-5-3-7(9)4-6(2)8-5;/h5-9H,3-4H2,1-2H3;1H/t5-,6+,7?; |
| InChIKey | IJIHNPOPPHLAHS-VPEOJXMDSA-N |
| XLogP | 0.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |