C31H53NO2 — CID 164889094
[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-(hydroxymethylamino)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methanol (PubChem CID 164889094) has the molecular formula C31H53NO2 and a molecular weight of 471.77 g/mol. Its IUPAC name is [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-(hydroxymethylamino)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methanol.
| Compound Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-(hydroxymethylamino)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methanol |
|---|---|
| PubChem CID | 164889094 |
| Molecular Formula | C31H53NO2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.41 |
| IUPAC Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-(hydroxymethylamino)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methanol |
| SMILES | CC1(C)CC[C@]2(CO)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](NCO)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C31H53NO2/c1-26(2)14-16-31(19-33)17-15-29(6)21(22(31)18-26)8-9-24-28(5)12-11-25(32-20-34)27(3,4)23(28)10-13-30(24,29)7/h8,22-25,32-34H,9-20H2,1-7H3/t22-,23-,24+,25-,28-,29+,30+,31+/m0/s1 |
| InChIKey | KJOLTDNRYGTPII-RJMCMVOWSA-N |
| XLogP | 6.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|