C23H29NO10 — CID 164889198
[(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-anilino-3-oxopropyl)oxan-2-yl]methyl acetate (PubChem CID 164889198) has the molecular formula C23H29NO10 and a molecular weight of 479.48 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-anilino-3-oxopropyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-anilino-3-oxopropyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 164889198 |
| Molecular Formula | C23H29NO10 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-anilino-3-oxopropyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](CCC(=O)Nc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29NO10/c1-13(25)30-12-19-22(32-15(3)27)23(33-16(4)28)21(31-14(2)26)18(34-19)10-11-20(29)24-17-8-6-5-7-9-17/h5-9,18-19,21-23H,10-12H2,1-4H3,(H,24,29)/t18-,19-,21+,22-,23-/m1/s1 |
| InChIKey | PNTIYTLMAZCBLE-OTRDUVHRSA-N |
| XLogP | 1.53 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|