C26H43NO11 — CID 164889199
methyl 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 164889199) has the molecular formula C26H43NO11 and a molecular weight of 545.63 g/mol. Its IUPAC name is methyl 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | methyl 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 164889199 |
| Molecular Formula | C26H43NO11 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | methyl 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | COC(=O)C(C[C@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@@H]21)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43NO11/c1-23(2,3)37-21(29)27(22(30)38-24(4,5)6)14(20(28)31-11)12-15-18-19(36-26(9,10)35-18)17(33-15)16-13-32-25(7,8)34-16/h14-19H,12-13H2,1-11H3/t14?,15-,16-,17-,18-,19+/m1/s1 |
| InChIKey | VTCWBAROLQYVBF-GUOCTZQRSA-N |
| XLogP | 3.53 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|