C27H33NO6 — CID 164889209
3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N,N-diphenylpropanamide (PubChem CID 164889209) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N,N-diphenylpropanamide.
| Compound Name | 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N,N-diphenylpropanamide |
|---|---|
| PubChem CID | 164889209 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 3-[(3aS,4R,6R,6aR)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N,N-diphenylpropanamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CCC(=O)N(c1ccccc1)c1ccccc1)O[C@@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C27H33NO6/c1-26(2)30-17-21(32-26)23-25-24(33-27(3,4)34-25)20(31-23)15-16-22(29)28(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21,23-25H,15-17H2,1-4H3/t20-,21-,23-,24-,25+/m1/s1 |
| InChIKey | QMDGZPDFDHJZTA-BYWXWQNBSA-N |
| XLogP | 4.57 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |