C41H56N2O9Si — CID 164889224
methyl (2S)-2-[[(2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 164889224) has the molecular formula C41H56N2O9Si and a molecular weight of 748.99 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 164889224 |
| Molecular Formula | C41H56N2O9Si |
| Molecular Weight | 748.99 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[3-[(2R,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]propanoylamino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C41H56N2O9Si/c1-27(2)24-32(40(49)50-6)43-39(48)31(25-28-16-10-7-11-17-28)42-35(44)23-22-33-36(45)38(47)37(46)34(52-33)26-51-53(41(3,4)5,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-21,27,31-34,36-38,45-47H,22-26H2,1-6H3,(H,42,44)(H,43,48)/t31-,32-,33+,34+,36-,37+,38+/m0/s1 |
| InChIKey | BXNNWERGEKRGGV-IQBGEGHYSA-N |
| XLogP | 2.62 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.99 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|