C19H27NO8 — CID 164889228
methyl (2S)-3-phenyl-2-[3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoylamino]propanoate (PubChem CID 164889228) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is methyl (2S)-3-phenyl-2-[3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoylamino]propanoate.
| Compound Name | methyl (2S)-3-phenyl-2-[3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoylamino]propanoate |
|---|---|
| PubChem CID | 164889228 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl (2S)-3-phenyl-2-[3-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanoylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CC[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H27NO8/c1-27-19(26)12(9-11-5-3-2-4-6-11)20-15(22)8-7-13-16(23)18(25)17(24)14(10-21)28-13/h2-6,12-14,16-18,21,23-25H,7-10H2,1H3,(H,20,22)/t12-,13+,14+,16-,17+,18+/m0/s1 |
| InChIKey | JQOHUZGEKBJWRA-HJOKPGJRSA-N |
| XLogP | -1.49 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |