C52H46Cl4F2N10O10S3 — CID 164889484
bis(3-[[4-[2-[2,6-diamino-5-(3,4-dichlorophenyl)pyrimidin-4-yl]ethyl]phenyl]methylcarbamoyl]benzenesulfonyl fluoride);sulfuric acid (PubChem CID 164889484) has the molecular formula C52H46Cl4F2N10O10S3 and a molecular weight of 1247.01 g/mol. Its IUPAC name is bis(3-[[4-[2-[2,6-diamino-5-(3,4-dichlorophenyl)pyrimidin-4-yl]ethyl]phenyl]methylcarbamoyl]benzenesulfonyl fluoride);sulfuric acid.
| Compound Name | bis(3-[[4-[2-[2,6-diamino-5-(3,4-dichlorophenyl)pyrimidin-4-yl]ethyl]phenyl]methylcarbamoyl]benzenesulfonyl fluoride);sulfuric acid |
|---|---|
| PubChem CID | 164889484 |
| Molecular Formula | C52H46Cl4F2N10O10S3 |
| Molecular Weight | 1247.01 g/mol |
| Exact Mass | 1244.13 |
| IUPAC Name | bis(3-[[4-[2-[2,6-diamino-5-(3,4-dichlorophenyl)pyrimidin-4-yl]ethyl]phenyl]methylcarbamoyl]benzenesulfonyl fluoride);sulfuric acid |
| SMILES | Nc1nc(N)c(-c2ccc(Cl)c(Cl)c2)c(CCc2ccc(CNC(=O)c3cccc(S(=O)(=O)F)c3)cc2)n1.Nc1nc(N)c(-c2ccc(Cl)c(Cl)c2)c(CCc2ccc(CNC(=O)c3cccc(S(=O)(=O)F)c3)cc2)n1.O=S(=O)(O)O |
| InChI | InChI=1S/2C26H22Cl2FN5O3S.H2O4S/c2*27-20-10-9-17(13-21(20)28)23-22(33-26(31)34-24(23)30)11-8-15-4-6-16(7-5-15)14-32-25(35)18-2-1-3-19(12-18)38(29,36)37;1-5(2,3)4/h2*1-7,9-10,12-13H,8,11,14H2,(H,32,35)(H4,30,31,33,34);(H2,1,2,3,4) |
| InChIKey | GBIOZRAEUQNVDX-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 356.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 81 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.01 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|