C26H30N4OS — CID 164889635
(1S,2R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-(pyrimidin-2-ylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol (PubChem CID 164889635) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is (1S,2R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-(pyrimidin-2-ylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol.
| Compound Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-(pyrimidin-2-ylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol |
|---|---|
| PubChem CID | 164889635 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (1S,2R,13R,14S,17R,18S)-17-ethynyl-2,18-dimethyl-7-(pyrimidin-2-ylamino)-6-thia-8-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),7,10-trien-17-ol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CC=C4c5nc(Nc6ncccn6)sc5CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H30N4OS/c1-4-26(31)13-9-18-16-6-7-19-21-20(32-23(29-21)30-22-27-14-5-15-28-22)10-11-24(19,2)17(16)8-12-25(18,26)3/h1,5,7,14-18,31H,6,8-13H2,2-3H3,(H,27,28,29,30)/t16-,17+,18+,24-,25+,26+/m1/s1 |
| InChIKey | XEZUQWHUJICURF-OYXDEKHKSA-N |
| XLogP | 5.22 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|