C15H24O4 — CID 164889781
(1'R,2'R,3'aR,6'aR)-3'a-(2-hydroxyethyl)-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde (PubChem CID 164889781) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1'R,2'R,3'aR,6'aR)-3'a-(2-hydroxyethyl)-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde.
| Compound Name | (1'R,2'R,3'aR,6'aR)-3'a-(2-hydroxyethyl)-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 164889781 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1'R,2'R,3'aR,6'aR)-3'a-(2-hydroxyethyl)-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde |
| SMILES | C[C@@H]1C[C@@]2(CCO)CCC3(OCCO3)[C@H]2[C@]1(C)C=O |
| InChI | InChI=1S/C15H24O4/c1-11-9-14(5-6-16)3-4-15(18-7-8-19-15)12(14)13(11,2)10-17/h10-12,16H,3-9H2,1-2H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | VTQMFOCAHQZZFK-RQJABVFESA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|