C16H26O4 — CID 164889818
(1'R,2'R,3'aR,6'aR)-3'a-[(2S)-1-hydroxypropan-2-yl]-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde (PubChem CID 164889818) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1'R,2'R,3'aR,6'aR)-3'a-[(2S)-1-hydroxypropan-2-yl]-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde.
| Compound Name | (1'R,2'R,3'aR,6'aR)-3'a-[(2S)-1-hydroxypropan-2-yl]-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 164889818 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1'R,2'R,3'aR,6'aR)-3'a-[(2S)-1-hydroxypropan-2-yl]-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-1'-carbaldehyde |
| SMILES | C[C@@H]1C[C@@]2([C@H](C)CO)CCC3(OCCO3)[C@H]2[C@]1(C)C=O |
| InChI | InChI=1S/C16H26O4/c1-11-8-15(12(2)9-17)4-5-16(19-6-7-20-16)13(15)14(11,3)10-18/h10-13,17H,4-9H2,1-3H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | JCBMOGIFBGUUAC-UXXRCYHCSA-N |
| XLogP | 2.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|