C17H26O4 — CID 164889863
(3aR,4R,5R,7aS)-4,5-dimethyl-7a-[(2S)-1-oxopropan-2-yl]spiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carbaldehyde (PubChem CID 164889863) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3aR,4R,5R,7aS)-4,5-dimethyl-7a-[(2S)-1-oxopropan-2-yl]spiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carbaldehyde.
| Compound Name | (3aR,4R,5R,7aS)-4,5-dimethyl-7a-[(2S)-1-oxopropan-2-yl]spiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carbaldehyde |
|---|---|
| PubChem CID | 164889863 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3aR,4R,5R,7aS)-4,5-dimethyl-7a-[(2S)-1-oxopropan-2-yl]spiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carbaldehyde |
| SMILES | C[C@@H]1CC[C@@]2([C@H](C)C=O)CCC3(OCCO3)[C@H]2[C@]1(C)C=O |
| InChI | InChI=1S/C17H26O4/c1-12-4-5-16(13(2)10-18)6-7-17(20-8-9-21-17)14(16)15(12,3)11-19/h10-14H,4-9H2,1-3H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | KJAZJIDSOMJAJD-LJIZCISZSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|