C20H22OS — CID 164890344
(2S,3R,5S)-2-methyl-3-naphthalen-2-ylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 164890344) has the molecular formula C20H22OS and a molecular weight of 310.46 g/mol. Its IUPAC name is (2S,3R,5S)-2-methyl-3-naphthalen-2-ylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | (2S,3R,5S)-2-methyl-3-naphthalen-2-ylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 164890344 |
| Molecular Formula | C20H22OS |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2S,3R,5S)-2-methyl-3-naphthalen-2-ylsulfanyl-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@H](C)[C@H](Sc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C20H22OS/c1-13(2)17-11-19(21)14(3)20(12-17)22-18-9-8-15-6-4-5-7-16(15)10-18/h4-10,14,17,20H,1,11-12H2,2-3H3/t14-,17-,20+/m0/s1 |
| InChIKey | QQQXLGVYUNSCOX-GZRFBZBPSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|