C34H34O6S — CID 164890476
[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 164890476) has the molecular formula C34H34O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 164890476 |
| Molecular Formula | C34H34O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34O6S/c1-24-17-19-28(20-18-24)41-34-32(40-33(36)27-15-9-4-10-16-27)31(38-23-26-13-7-3-8-14-26)30(29(21-35)39-34)37-22-25-11-5-2-6-12-25/h2-20,29-32,34-35H,21-23H2,1H3/t29-,30-,31+,32-,34+/m1/s1 |
| InChIKey | PIVMNSKMOVQDQA-PUPFNBACSA-N |
| XLogP | 6.20 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |