About (5-cyclopropyl-2,4-difluorophenyl)boronic acid
(5-cyclopropyl-2,4-difluorophenyl)boronic acid (PubChem CID 164891697) has the molecular formula C9H9BF2O2
and a molecular weight of 197.98 g/mol. Its IUPAC name is (5-cyclopropyl-2,4-difluorophenyl)boronic acid.
Molecular Properties
| Compound Name | (5-cyclopropyl-2,4-difluorophenyl)boronic acid |
| PubChem CID | 164891697 |
| Molecular Formula | C9H9BF2O2 |
| Molecular Weight | 197.98 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (5-cyclopropyl-2,4-difluorophenyl)boronic acid |
| SMILES | OB(O)c1cc(C2CC2)c(F)cc1F |
| InChI | InChI=1S/C9H9BF2O2/c11-8-4-9(12)7(10(13)14)3-6(8)5-1-2-5/h3-5,13-14H,1-2H2 |
| InChIKey | WSISCCUPFINRQR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.98 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-cyclopropyl-2,4-difluorophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-2,4-difluorophenyl)boronic acid?
The IUPAC name of (5-cyclopropyl-2,4-difluorophenyl)boronic acid (CID 164891697) is (5-cyclopropyl-2,4-difluorophenyl)boronic acid.
What is the SMILES notation for (5-cyclopropyl-2,4-difluorophenyl)boronic acid?
The canonical SMILES for (5-cyclopropyl-2,4-difluorophenyl)boronic acid is OB(O)c1cc(C2CC2)c(F)cc1F.
What is the InChIKey of (5-cyclopropyl-2,4-difluorophenyl)boronic acid?
The InChIKey is WSISCCUPFINRQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BF2O2/c11-8-4-9(12)7(10(13)14)3-6(8)5-1-2-5/h3-5,13-14H,1-2H2.
What are the key properties of (5-cyclopropyl-2,4-difluorophenyl)boronic acid?
(5-cyclopropyl-2,4-difluorophenyl)boronic acid has a molecular weight of 197.98 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-2,4-difluorophenyl)boronic acid is sourced from PubChem (CID 164891697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).