C14H12F2OS — CID 164892505
1,3-difluoro-2-methylsulfanyl-4-phenylmethoxybenzene (PubChem CID 164892505) has the molecular formula C14H12F2OS and a molecular weight of 266.31 g/mol. Its IUPAC name is 1,3-difluoro-2-methylsulfanyl-4-phenylmethoxybenzene.
| Compound Name | 1,3-difluoro-2-methylsulfanyl-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 164892505 |
| Molecular Formula | C14H12F2OS |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1,3-difluoro-2-methylsulfanyl-4-phenylmethoxybenzene |
| SMILES | CSc1c(F)ccc(OCc2ccccc2)c1F |
| InChI | InChI=1S/C14H12F2OS/c1-18-14-11(15)7-8-12(13(14)16)17-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3 |
| InChIKey | YWZKGUCIGFERPH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |