C7H6Br2FNO — CID 164894161
1-(2,6-dibromo-3-fluoro-4-pyridinyl)ethanol (PubChem CID 164894161) has the molecular formula C7H6Br2FNO and a molecular weight of 298.94 g/mol. Its IUPAC name is 1-(2,6-dibromo-3-fluoro-4-pyridinyl)ethanol.
| Compound Name | 1-(2,6-dibromo-3-fluoro-4-pyridinyl)ethanol |
|---|---|
| PubChem CID | 164894161 |
| Molecular Formula | C7H6Br2FNO |
| Molecular Weight | 298.94 g/mol |
| Exact Mass | 296.88 |
| IUPAC Name | 1-(2,6-dibromo-3-fluoro-4-pyridinyl)ethanol |
| SMILES | CC(O)c1cc(Br)nc(Br)c1F |
| InChI | InChI=1S/C7H6Br2FNO/c1-3(12)4-2-5(8)11-7(9)6(4)10/h2-3,12H,1H3 |
| InChIKey | JBPJASLIQFLYRR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|