C20H11F7O2 — CID 164895353
1-fluoro-3,5-bis[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 164895353) has the molecular formula C20H11F7O2 and a molecular weight of 416.29 g/mol. Its IUPAC name is 1-fluoro-3,5-bis[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-fluoro-3,5-bis[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 164895353 |
| Molecular Formula | C20H11F7O2 |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1-fluoro-3,5-bis[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | Fc1cc(-c2ccc(OC(F)(F)F)cc2)cc(-c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H11F7O2/c21-16-10-14(12-1-5-17(6-2-12)28-19(22,23)24)9-15(11-16)13-3-7-18(8-4-13)29-20(25,26)27/h1-11H |
| InChIKey | OBZWGFJBDPCSHB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |