C16H17Br2ClN2O2S — CID 164897431
7,9-dibromo-3-chloro-N-(2-methylpropyl)-8,9-dihydro-7H-cyclopenta[h]isoquinoline-5-sulfonamide (PubChem CID 164897431) has the molecular formula C16H17Br2ClN2O2S and a molecular weight of 496.65 g/mol. Its IUPAC name is 7,9-dibromo-3-chloro-N-(2-methylpropyl)-8,9-dihydro-7H-cyclopenta[h]isoquinoline-5-sulfonamide.
| Compound Name | 7,9-dibromo-3-chloro-N-(2-methylpropyl)-8,9-dihydro-7H-cyclopenta[h]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 164897431 |
| Molecular Formula | C16H17Br2ClN2O2S |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 493.91 |
| IUPAC Name | 7,9-dibromo-3-chloro-N-(2-methylpropyl)-8,9-dihydro-7H-cyclopenta[h]isoquinoline-5-sulfonamide |
| SMILES | CC(C)CNS(=O)(=O)c1cc2c(c3cnc(Cl)cc13)C(Br)CC2Br |
| InChI | InChI=1S/C16H17Br2ClN2O2S/c1-8(2)6-21-24(22,23)14-3-10-12(17)5-13(18)16(10)11-7-20-15(19)4-9(11)14/h3-4,7-8,12-13,21H,5-6H2,1-2H3 |
| InChIKey | KMTHFKJQIXXUAY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|