C19H15NO — CID 164898492
7-ethyl-2-phenylbenzo[g][1,3]benzoxazole (PubChem CID 164898492) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is 7-ethyl-2-phenylbenzo[g][1,3]benzoxazole.
| Compound Name | 7-ethyl-2-phenylbenzo[g][1,3]benzoxazole |
|---|---|
| PubChem CID | 164898492 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 7-ethyl-2-phenylbenzo[g][1,3]benzoxazole |
| SMILES | CCc1ccc2c(ccc3nc(-c4ccccc4)oc32)c1 |
| InChI | InChI=1S/C19H15NO/c1-2-13-8-10-16-15(12-13)9-11-17-18(16)21-19(20-17)14-6-4-3-5-7-14/h3-12H,2H2,1H3 |
| InChIKey | ABUAKILEJLCQIG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |