C27H52O5Si — CID 164898637
3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-[2-[2-(2,2,6-trimethylcyclohexyl)ethyl]pentoxy]pentanoic acid (PubChem CID 164898637) has the molecular formula C27H52O5Si and a molecular weight of 484.79 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-[2-[2-(2,2,6-trimethylcyclohexyl)ethyl]pentoxy]pentanoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-[2-[2-(2,2,6-trimethylcyclohexyl)ethyl]pentoxy]pentanoic acid |
|---|---|
| PubChem CID | 164898637 |
| Molecular Formula | C27H52O5Si |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-5-[2-[2-(2,2,6-trimethylcyclohexyl)ethyl]pentoxy]pentanoic acid |
| SMILES | CCCC(CCC1C(C)CCCC1(C)C)COC(=O)CC(CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O5Si/c1-10-12-21(14-15-23-20(2)13-11-16-27(23,6)7)19-31-25(30)18-22(17-24(28)29)32-33(8,9)26(3,4)5/h20-23H,10-19H2,1-9H3,(H,28,29) |
| InChIKey | IBBNASBLRYOGFB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|