About N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide
N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide (PubChem CID 164898687) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide |
| PubChem CID | 164898687 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-12(16)15-9-10-3-5-11(6-4-10)13-14-7-8-17-13/h2-6H,1,7-9H2,(H,15,16) |
| InChIKey | RRXAVSVNNOHDGL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide?
The IUPAC name of N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide (CID 164898687) is N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide.
What is the SMILES notation for N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide?
The canonical SMILES for N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide is C=CC(=O)NCc1ccc(C2=NCCO2)cc1.
What is the InChIKey of N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide?
The InChIKey is RRXAVSVNNOHDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-2-12(16)15-9-10-3-5-11(6-4-10)13-14-7-8-17-13/h2-6H,1,7-9H2,(H,15,16).
What are the key properties of N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide?
N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide has a molecular weight of 230.27 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]methyl]prop-2-enamide is sourced from PubChem (CID 164898687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).