C14H15F3N4O4 — CID 164899181
propan-2-yl 3-[[1-oxido-7-(trifluoromethoxy)-1,2,4-benzotriazin-1-ium-3-yl]amino]propanoate (PubChem CID 164899181) has the molecular formula C14H15F3N4O4 and a molecular weight of 360.29 g/mol. Its IUPAC name is propan-2-yl 3-[[1-oxido-7-(trifluoromethoxy)-1,2,4-benzotriazin-1-ium-3-yl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[1-oxido-7-(trifluoromethoxy)-1,2,4-benzotriazin-1-ium-3-yl]amino]propanoate |
|---|---|
| PubChem CID | 164899181 |
| Molecular Formula | C14H15F3N4O4 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | propan-2-yl 3-[[1-oxido-7-(trifluoromethoxy)-1,2,4-benzotriazin-1-ium-3-yl]amino]propanoate |
| SMILES | CC(C)OC(=O)CCNc1nc2ccc(OC(F)(F)F)cc2[n+]([O-])n1 |
| InChI | InChI=1S/C14H15F3N4O4/c1-8(2)24-12(22)5-6-18-13-19-10-4-3-9(25-14(15,16)17)7-11(10)21(23)20-13/h3-4,7-8H,5-6H2,1-2H3,(H,18,19,20) |
| InChIKey | HEOHBTUFSJGNLV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|