C33H37BFNO6 — CID 164899435
N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-fluoro-2-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylacetamide (PubChem CID 164899435) has the molecular formula C33H37BFNO6 and a molecular weight of 573.47 g/mol. Its IUPAC name is N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-fluoro-2-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylacetamide.
| Compound Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-fluoro-2-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylacetamide |
|---|---|
| PubChem CID | 164899435 |
| Molecular Formula | C33H37BFNO6 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | N-[(1R)-2-(1-benzofuran-3-yl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-fluoro-2-spiro[3H-2-benzofuran-1,3'-oxolane]-5-ylacetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cc4coc5ccccc45)NC(=O)C(F)c4ccc5c(c4)COC54CCOC4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C33H37BFNO6/c1-31(2)22-14-26(31)32(3)27(15-22)41-34(42-32)28(13-20-16-39-25-7-5-4-6-23(20)25)36-30(37)29(35)19-8-9-24-21(12-19)17-40-33(24)10-11-38-18-33/h4-9,12,16,22,26-29H,10-11,13-15,17-18H2,1-3H3,(H,36,37)/t22-,26-,27+,28-,29?,32-,33?/m0/s1 |
| InChIKey | VVKZEKOYDBXATL-ITOWRETNSA-N |
| XLogP | 5.58 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|