About 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione
7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione (PubChem CID 164899626) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione.
Molecular Properties
| Compound Name | 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione |
| PubChem CID | 164899626 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione |
| SMILES | COc1ccc(-n2c(C)cc3cc[nH]c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C16H14N2O3/c1-10-9-11-7-8-17-15(19)14(11)16(20)18(10)12-3-5-13(21-2)6-4-12/h3-9H,1-2H3,(H,17,19) |
| InChIKey | PJZZWKUZWNJPNR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione?
The IUPAC name of 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione (CID 164899626) is 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione.
What is the SMILES notation for 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione?
The canonical SMILES for 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione is COc1ccc(-n2c(C)cc3cc[nH]c(=O)c3c2=O)cc1.
What is the InChIKey of 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione?
The InChIKey is PJZZWKUZWNJPNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-10-9-11-7-8-17-15(19)14(11)16(20)18(10)12-3-5-13(21-2)6-4-12/h3-9H,1-2H3,(H,17,19).
What are the key properties of 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione?
7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione has a molecular weight of 282.30 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methoxyphenyl)-6-methyl-2H-2,7-naphthyridine-1,8-dione is sourced from PubChem (CID 164899626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).