C8H18N2O — CID 164899965
(3,5,6-trimethylpiperazin-2-yl)methanol (PubChem CID 164899965) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is (3,5,6-trimethylpiperazin-2-yl)methanol.
| Compound Name | (3,5,6-trimethylpiperazin-2-yl)methanol |
|---|---|
| PubChem CID | 164899965 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | (3,5,6-trimethylpiperazin-2-yl)methanol |
| SMILES | CC1NC(C)C(CO)NC1C |
| InChI | InChI=1S/C8H18N2O/c1-5-6(2)10-8(4-11)7(3)9-5/h5-11H,4H2,1-3H3 |
| InChIKey | NFBRGKRQYNQYRO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |