C16H19NO2 — CID 164900469
tert-butyl 4-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-11-carboxylate (PubChem CID 164900469) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl 4-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-11-carboxylate.
| Compound Name | tert-butyl 4-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 164900469 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | tert-butyl 4-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene-11-carboxylate |
| SMILES | Cc1ccc2c(c1)C1C=CC2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19NO2/c1-10-5-6-11-12(9-10)14-8-7-13(11)17(14)15(18)19-16(2,3)4/h5-9,13-14H,1-4H3 |
| InChIKey | CMNLHNPMALABIS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|