C28H29ClN6O4 — CID 164900917
1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-pyridin-4-ylurea (PubChem CID 164900917) has the molecular formula C28H29ClN6O4 and a molecular weight of 549.03 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-pyridin-4-ylurea.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 164900917 |
| Molecular Formula | C28H29ClN6O4 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-pyridin-4-ylurea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Nc4ccncc4)c(Cl)c3)ncnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C28H29ClN6O4/c1-37-25-16-21-24(17-26(25)38-14-4-13-35-11-2-3-12-35)31-18-32-27(21)39-20-5-6-23(22(29)15-20)34-28(36)33-19-7-9-30-10-8-19/h5-10,15-18H,2-4,11-14H2,1H3,(H2,30,33,34,36) |
| InChIKey | HUBJRBJFRJHZIG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|