C31H34ClN5O6 — CID 164900955
1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 164900955) has the molecular formula C31H34ClN5O6 and a molecular weight of 608.10 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 164900955 |
| Molecular Formula | C31H34ClN5O6 |
| Molecular Weight | 608.10 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]oxyphenyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Oc3ncnc4cc(OCCCN5CCCC5)c(OC)cc34)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C31H34ClN5O6/c1-39-20-7-10-25(27(16-20)40-2)36-31(38)35-24-9-8-21(15-23(24)32)43-30-22-17-28(41-3)29(18-26(22)33-19-34-30)42-14-6-13-37-11-4-5-12-37/h7-10,15-19H,4-6,11-14H2,1-3H3,(H2,35,36,38) |
| InChIKey | XWFXAJNJXGILIN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.10 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|