C18H33OPt-3 — CID 164901558
carbanide;4,8-dimethyl-7-propan-2-yl-1,2,3,3a,8,8a-hexahydroazulen-1-ol;platinum (PubChem CID 164901558) has the molecular formula C18H33OPt-3 and a molecular weight of 460.54 g/mol. Its IUPAC name is carbanide;4,8-dimethyl-7-propan-2-yl-1,2,3,3a,8,8a-hexahydroazulen-1-ol;platinum.
| Compound Name | carbanide;4,8-dimethyl-7-propan-2-yl-1,2,3,3a,8,8a-hexahydroazulen-1-ol;platinum |
|---|---|
| PubChem CID | 164901558 |
| Molecular Formula | C18H33OPt-3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | carbanide;4,8-dimethyl-7-propan-2-yl-1,2,3,3a,8,8a-hexahydroazulen-1-ol;platinum |
| SMILES | CC1=CC=C(C(C)C)C(C)C2C(O)CCC12.[CH3-].[CH3-].[CH3-].[Pt] |
| InChI | InChI=1S/C15H24O.3CH3.Pt/c1-9(2)12-6-5-10(3)13-7-8-14(16)15(13)11(12)4;;;;/h5-6,9,11,13-16H,7-8H2,1-4H3;3*1H3;/q;3*-1; |
| InChIKey | BDNMPMMRRYENFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|