C15H24O — CID 164901565
1-methoxy-4-methyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene (PubChem CID 164901565) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methoxy-4-methyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene.
| Compound Name | 1-methoxy-4-methyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene |
|---|---|
| PubChem CID | 164901565 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-methoxy-4-methyl-7-propan-2-yl-1,2,3,3a,6,8a-hexahydroazulene |
| SMILES | COC1CCC2C(C)=CCC(C(C)C)=CC12 |
| InChI | InChI=1S/C15H24O/c1-10(2)12-6-5-11(3)13-7-8-15(16-4)14(13)9-12/h5,9-10,13-15H,6-8H2,1-4H3 |
| InChIKey | RJBVBWZAKDWFMQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|