C21H28N6O5 — CID 164901899
tert-butyl 2-[4-[2-(cyclopropanecarbonyl)hydrazinyl]-7-morpholin-4-yl-2-oxopyrido[3,2-d]pyrimidin-1-yl]acetate (PubChem CID 164901899) has the molecular formula C21H28N6O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-(cyclopropanecarbonyl)hydrazinyl]-7-morpholin-4-yl-2-oxopyrido[3,2-d]pyrimidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[2-(cyclopropanecarbonyl)hydrazinyl]-7-morpholin-4-yl-2-oxopyrido[3,2-d]pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 164901899 |
| Molecular Formula | C21H28N6O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | tert-butyl 2-[4-[2-(cyclopropanecarbonyl)hydrazinyl]-7-morpholin-4-yl-2-oxopyrido[3,2-d]pyrimidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(=O)nc(NNC(=O)C2CC2)c2ncc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C21H28N6O5/c1-21(2,3)32-16(28)12-27-15-10-14(26-6-8-31-9-7-26)11-22-17(15)18(23-20(27)30)24-25-19(29)13-4-5-13/h10-11,13H,4-9,12H2,1-3H3,(H,25,29)(H,23,24,30) |
| InChIKey | YGHLPARCPGVJAO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|