C21H24ClN5O — CID 164902194
2-chloro-N-[[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-1-bicyclo[1.1.1]pentanyl]methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 164902194) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-chloro-N-[[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-1-bicyclo[1.1.1]pentanyl]methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 2-chloro-N-[[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-1-bicyclo[1.1.1]pentanyl]methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 164902194 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-chloro-N-[[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yloxymethyl)-1-bicyclo[1.1.1]pentanyl]methyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Clc1cc2c(NCC34CC(COC5CCn6ccnc6C5)(C3)C4)ccnc2[nH]1 |
| InChI | InChI=1S/C21H24ClN5O/c22-17-8-15-16(1-3-24-19(15)26-17)25-12-20-9-21(10-20,11-20)13-28-14-2-5-27-6-4-23-18(27)7-14/h1,3-4,6,8,14H,2,5,7,9-13H2,(H2,24,25,26) |
| InChIKey | SLMLRIQQWJVVMJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |