C14H26N6O2 — CID 164902537
azane;tert-butyl N-(1-amino-2-imino-4-methyl-3H-quinoxalin-5-yl)carbamate;molecular hydrogen (PubChem CID 164902537) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is azane;tert-butyl N-(1-amino-2-imino-4-methyl-3H-quinoxalin-5-yl)carbamate;molecular hydrogen.
| Compound Name | azane;tert-butyl N-(1-amino-2-imino-4-methyl-3H-quinoxalin-5-yl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 164902537 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | azane;tert-butyl N-(1-amino-2-imino-4-methyl-3H-quinoxalin-5-yl)carbamate;molecular hydrogen |
| SMILES | N.[H]/N=C1\CN(C)c2c(NC(=O)OC(C)(C)C)cccc2N1N.[H][H] |
| InChI | InChI=1S/C14H21N5O2.H3N.H2/c1-14(2,3)21-13(20)17-9-6-5-7-10-12(9)18(4)8-11(15)19(10)16;;/h5-7,15H,8,16H2,1-4H3,(H,17,20);1H3;1H/b15-11+;; |
| InChIKey | VUBJTDASDVEWBJ-BXGYHSFXSA-N |
| XLogP | 2.55 |
| TPSA | 129.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|