C8H13ClN2O — CID 164902787
4-chloro-2,5-dimethylpyridazin-3-one;ethane (PubChem CID 164902787) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is 4-chloro-2,5-dimethylpyridazin-3-one;ethane.
| Compound Name | 4-chloro-2,5-dimethylpyridazin-3-one;ethane |
|---|---|
| PubChem CID | 164902787 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-chloro-2,5-dimethylpyridazin-3-one;ethane |
| SMILES | CC.Cc1cnn(C)c(=O)c1Cl |
| InChI | InChI=1S/C6H7ClN2O.C2H6/c1-4-3-8-9(2)6(10)5(4)7;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | KIVBCRZMUOOXKR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |