About 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline
2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline (PubChem CID 164902844) has the molecular formula C12H13N5O2
and a molecular weight of 259.27 g/mol. Its IUPAC name is 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline |
| PubChem CID | 164902844 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline |
| SMILES | CC1c2nn(C)nc2-c2cccc([N+](=O)[O-])c2N1C |
| InChI | InChI=1S/C12H13N5O2/c1-7-10-11(14-16(3)13-10)8-5-4-6-9(17(18)19)12(8)15(7)2/h4-7H,1-3H3 |
| InChIKey | ISHWMGZFEYQJNR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline?
The IUPAC name of 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline (CID 164902844) is 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline.
What is the SMILES notation for 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline?
The canonical SMILES for 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline is CC1c2nn(C)nc2-c2cccc([N+](=O)[O-])c2N1C.
What is the InChIKey of 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline?
The InChIKey is ISHWMGZFEYQJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O2/c1-7-10-11(14-16(3)13-10)8-5-4-6-9(17(18)19)12(8)15(7)2/h4-7H,1-3H3.
What are the key properties of 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline?
2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline has a molecular weight of 259.27 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-6-nitro-4H-triazolo[4,5-c]quinoline is sourced from PubChem (CID 164902844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).