C12H13BrF2N4 — CID 164902894
1-[2-(3-bromo-2,5-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-N-methylethanamine (PubChem CID 164902894) has the molecular formula C12H13BrF2N4 and a molecular weight of 331.16 g/mol. Its IUPAC name is 1-[2-(3-bromo-2,5-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-N-methylethanamine.
| Compound Name | 1-[2-(3-bromo-2,5-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 164902894 |
| Molecular Formula | C12H13BrF2N4 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-[2-(3-bromo-2,5-difluorophenyl)-5-methyl-1,2,4-triazol-3-yl]-N-methylethanamine |
| SMILES | CNC(C)c1nc(C)nn1-c1cc(F)cc(Br)c1F |
| InChI | InChI=1S/C12H13BrF2N4/c1-6(16-3)12-17-7(2)18-19(12)10-5-8(14)4-9(13)11(10)15/h4-6,16H,1-3H3 |
| InChIKey | HPOIDBLGUHLOJK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|