C30H31F5N6OS — CID 164903794
4-[4-(cyclohexylamino)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-(trifluoromethyl)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine (PubChem CID 164903794) has the molecular formula C30H31F5N6OS and a molecular weight of 618.68 g/mol. Its IUPAC name is 4-[4-(cyclohexylamino)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-(trifluoromethyl)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | 4-[4-(cyclohexylamino)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-(trifluoromethyl)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 164903794 |
| Molecular Formula | C30H31F5N6OS |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 4-[4-(cyclohexylamino)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-(trifluoromethyl)quinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(-c3c(C(F)(F)F)cc4c(NC5CCCCC5)nc(OCC56CCCN5CCC6)nc4c3F)ccc(F)c2s1 |
| InChI | InChI=1S/C30H31F5N6OS/c31-20-9-8-17(24-25(20)43-27(36)38-24)21-19(30(33,34)35)14-18-23(22(21)32)39-28(40-26(18)37-16-6-2-1-3-7-16)42-15-29-10-4-12-41(29)13-5-11-29/h8-9,14,16H,1-7,10-13,15H2,(H2,36,38)(H,37,39,40) |
| InChIKey | DHGYULJPGAMSBR-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |