C11H23NO2 — CID 164904001
ethane;[(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 164904001) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;[(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | ethane;[(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 164904001 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;[(2R,8S)-2-methoxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | CC.CO[C@H]1CN2CCC[C@@]2(CO)C1 |
| InChI | InChI=1S/C9H17NO2.C2H6/c1-12-8-5-9(7-11)3-2-4-10(9)6-8;1-2/h8,11H,2-7H2,1H3;1-2H3/t8-,9+;/m1./s1 |
| InChIKey | YMVAAWNXUBINQM-RJUBDTSPSA-N |
| XLogP | 1.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |